C18H23N3O4S — CID 108883825
1-[3-(2-methylphenoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]urea (PubChem CID 108883825) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-[3-(2-methylphenoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]urea.
| Compound Name | 1-[3-(2-methylphenoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]urea |
|---|---|
| PubChem CID | 108883825 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-[3-(2-methylphenoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]urea |
| SMILES | Cc1ccccc1OCCCNC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H23N3O4S/c1-14-5-2-3-6-17(14)25-12-4-11-20-18(22)21-13-15-7-9-16(10-8-15)26(19,23)24/h2-3,5-10H,4,11-13H2,1H3,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | ATDJWVFSPZQFRS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|