C17H28NO4P — CID 11067811
(2R)-2-[[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]amino]-2-phenylethanol (PubChem CID 11067811) has the molecular formula C17H28NO4P and a molecular weight of 341.39 g/mol. Its IUPAC name is (2R)-2-[[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 11067811 |
| Molecular Formula | C17H28NO4P |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2R)-2-[[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]amino]-2-phenylethanol |
| SMILES | COP(=O)(OC)[C@@H](N[C@@H](CO)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H28NO4P/c1-21-23(20,22-2)17(15-11-7-4-8-12-15)18-16(13-19)14-9-5-3-6-10-14/h3,5-6,9-10,15-19H,4,7-8,11-13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | YJXCLBWSDPKNDA-DLBZAZTESA-N |
| XLogP | 3.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|