C12H12BrNO3S2 — CID 110678457
4-bromo-N-[(4-methoxyphenyl)methyl]thiophene-2-sulfonamide (PubChem CID 110678457) has the molecular formula C12H12BrNO3S2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 4-bromo-N-[(4-methoxyphenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 4-bromo-N-[(4-methoxyphenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110678457 |
| Molecular Formula | C12H12BrNO3S2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | 4-bromo-N-[(4-methoxyphenyl)methyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C12H12BrNO3S2/c1-17-11-4-2-9(3-5-11)7-14-19(15,16)12-6-10(13)8-18-12/h2-6,8,14H,7H2,1H3 |
| InChIKey | LEEQNGPWZPYRFM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |