C15H18N4O3 — CID 110678672
1-[5-(furan-2-yl)-1-methylpyrazole-3-carbonyl]piperidine-4-carboxamide (PubChem CID 110678672) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-[5-(furan-2-yl)-1-methylpyrazole-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[5-(furan-2-yl)-1-methylpyrazole-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110678672 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[5-(furan-2-yl)-1-methylpyrazole-3-carbonyl]piperidine-4-carboxamide |
| SMILES | Cn1nc(C(=O)N2CCC(C(N)=O)CC2)cc1-c1ccco1 |
| InChI | InChI=1S/C15H18N4O3/c1-18-12(13-3-2-8-22-13)9-11(17-18)15(21)19-6-4-10(5-7-19)14(16)20/h2-3,8-10H,4-7H2,1H3,(H2,16,20) |
| InChIKey | GMVPEAVQSSCGNY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |