C19H18ClN3O2 — CID 86877598
[1-(3-chlorophenyl)-5-(furan-2-yl)pyrazol-3-yl]-(3-methylpyrrolidin-1-yl)methanone (PubChem CID 86877598) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.82 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-5-(furan-2-yl)pyrazol-3-yl]-(3-methylpyrrolidin-1-yl)methanone.
| Compound Name | [1-(3-chlorophenyl)-5-(furan-2-yl)pyrazol-3-yl]-(3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 86877598 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [1-(3-chlorophenyl)-5-(furan-2-yl)pyrazol-3-yl]-(3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2cc(-c3ccco3)n(-c3cccc(Cl)c3)n2)C1 |
| InChI | InChI=1S/C19H18ClN3O2/c1-13-7-8-22(12-13)19(24)16-11-17(18-6-3-9-25-18)23(21-16)15-5-2-4-14(20)10-15/h2-6,9-11,13H,7-8,12H2,1H3 |
| InChIKey | UROOPDONODIPHJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |