C18H36O4Si — CID 11067931
[(6S)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxoheptan-2-yl] 2,2-dimethylpropanoate (PubChem CID 11067931) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is [(6S)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxoheptan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(6S)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxoheptan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11067931 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(6S)-6-[tert-butyl(dimethyl)silyl]oxy-7-oxoheptan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(CCC[C@@H](C=O)O[Si](C)(C)C(C)(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-14(21-16(20)17(2,3)4)11-10-12-15(13-19)22-23(8,9)18(5,6)7/h13-15H,10-12H2,1-9H3/t14?,15-/m0/s1 |
| InChIKey | NMHFKSCODXZEOS-LOACHALJSA-N |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|