C16H18N2O4 — CID 110679362
ethyl 2-[3-(2-methyl-1,3-oxazol-4-yl)propanoylamino]benzoate (PubChem CID 110679362) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethyl 2-[3-(2-methyl-1,3-oxazol-4-yl)propanoylamino]benzoate.
| Compound Name | ethyl 2-[3-(2-methyl-1,3-oxazol-4-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 110679362 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | ethyl 2-[3-(2-methyl-1,3-oxazol-4-yl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CCc1coc(C)n1 |
| InChI | InChI=1S/C16H18N2O4/c1-3-21-16(20)13-6-4-5-7-14(13)18-15(19)9-8-12-10-22-11(2)17-12/h4-7,10H,3,8-9H2,1-2H3,(H,18,19) |
| InChIKey | TVUMATSFLBXTPA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |