C12H10Cl2N2OS — CID 110679766
N-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-5-yl)acetamide (PubChem CID 110679766) has the molecular formula C12H10Cl2N2OS and a molecular weight of 301.20 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110679766 |
| Molecular Formula | C12H10Cl2N2OS |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1ncsc1CC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl2N2OS/c1-7-10(18-6-15-7)5-11(17)16-9-4-2-3-8(13)12(9)14/h2-4,6H,5H2,1H3,(H,16,17) |
| InChIKey | BXTAMNVIDVKQJR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |