C13H14N2O3 — CID 110683012
2-methyl-3-oxo-N-prop-2-enyl-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 110683012) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-prop-2-enyl-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-prop-2-enyl-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 110683012 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-methyl-3-oxo-N-prop-2-enyl-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | C=CCNC(=O)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C13H14N2O3/c1-3-6-14-13(17)9-4-5-11-10(7-9)15-12(16)8(2)18-11/h3-5,7-8H,1,6H2,2H3,(H,14,17)(H,15,16) |
| InChIKey | LGBPPOGKCIADBY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|