C18H17N3O4 — CID 110683465
2-[3-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)propanoylamino]benzamide (PubChem CID 110683465) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[3-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)propanoylamino]benzamide.
| Compound Name | 2-[3-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 110683465 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[3-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)propanoylamino]benzamide |
| SMILES | Cn1c(=O)oc2ccc(CCC(=O)Nc3ccccc3C(N)=O)cc21 |
| InChI | InChI=1S/C18H17N3O4/c1-21-14-10-11(6-8-15(14)25-18(21)24)7-9-16(22)20-13-5-3-2-4-12(13)17(19)23/h2-6,8,10H,7,9H2,1H3,(H2,19,23)(H,20,22) |
| InChIKey | JDVFSDIKEFLNBY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |