6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid

C14H17NO4 — CID 98033149

IUPAC6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid
SMILESCn1c(=O)oc2ccc(CCCCCC(=O)O)cc21
InChIInChI=1S/C14H17NO4/c1-15-11-9-10(5-3-2-4-6-13(16)17)7-8-12(11)19-14(15)18/h7-9H,2-6H2,1H3,(H,16,17)
InChIKeySREOVUPSAAGUQO-UHFFFAOYSA-N
MW263.29 g/mol
LogP2.32
Rot. Bonds6

About 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid

6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid (PubChem CID 98033149) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid.

Molecular Properties

Compound Name6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid
PubChem CID98033149
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid
SMILESCn1c(=O)oc2ccc(CCCCCC(=O)O)cc21
InChIInChI=1S/C14H17NO4/c1-15-11-9-10(5-3-2-4-6-13(16)17)7-8-12(11)19-14(15)18/h7-9H,2-6H2,1H3,(H,16,17)
InChIKeySREOVUPSAAGUQO-UHFFFAOYSA-N
XLogP2.32
TPSA72.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 52.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid?
The IUPAC name of 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid (CID 98033149) is 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid.
What is the SMILES notation for 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid?
The canonical SMILES for 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid is Cn1c(=O)oc2ccc(CCCCCC(=O)O)cc21.
What is the InChIKey of 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid?
The InChIKey is SREOVUPSAAGUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-15-11-9-10(5-3-2-4-6-13(16)17)7-8-12(11)19-14(15)18/h7-9H,2-6H2,1H3,(H,16,17).
What are the key properties of 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid?
6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid has a molecular weight of 263.29 g/mol, XLogP of 2.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)hexanoic acid is sourced from PubChem (CID 98033149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).