C13H13NO4 — CID 116865969
(E)-5-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)pent-2-enoic acid (PubChem CID 116865969) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (E)-5-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)pent-2-enoic acid.
| Compound Name | (E)-5-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)pent-2-enoic acid |
|---|---|
| PubChem CID | 116865969 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (E)-5-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)pent-2-enoic acid |
| SMILES | Cn1c(=O)oc2ccc(CC/C=C/C(=O)O)cc21 |
| InChI | InChI=1S/C13H13NO4/c1-14-10-8-9(4-2-3-5-12(15)16)6-7-11(10)18-13(14)17/h3,5-8H,2,4H2,1H3,(H,15,16)/b5-3+ |
| InChIKey | CCKZGQITOCYLLP-HWKANZROSA-N |
| XLogP | 1.70 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|