C12H9ClF3N3O — CID 110684225
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1H-imidazol-5-yl)acetamide (PubChem CID 110684225) has the molecular formula C12H9ClF3N3O and a molecular weight of 303.67 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1H-imidazol-5-yl)acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1H-imidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110684225 |
| Molecular Formula | C12H9ClF3N3O |
| Molecular Weight | 303.67 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1H-imidazol-5-yl)acetamide |
| SMILES | O=C(Cc1cnc[nH]1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H9ClF3N3O/c13-7-1-2-10(9(3-7)12(14,15)16)19-11(20)4-8-5-17-6-18-8/h1-3,5-6H,4H2,(H,17,18)(H,19,20) |
| InChIKey | SBGIURYTGLVPHS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |