C11H16N2O2 — CID 110684617
2-methyl-4-propan-2-yl-N-prop-2-enyl-1,3-oxazole-5-carboxamide (PubChem CID 110684617) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-methyl-4-propan-2-yl-N-prop-2-enyl-1,3-oxazole-5-carboxamide.
| Compound Name | 2-methyl-4-propan-2-yl-N-prop-2-enyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110684617 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-methyl-4-propan-2-yl-N-prop-2-enyl-1,3-oxazole-5-carboxamide |
| SMILES | C=CCNC(=O)c1oc(C)nc1C(C)C |
| InChI | InChI=1S/C11H16N2O2/c1-5-6-12-11(14)10-9(7(2)3)13-8(4)15-10/h5,7H,1,6H2,2-4H3,(H,12,14) |
| InChIKey | BCPXHCHOPSLPQG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|