C16H21ClN2O2 — CID 110686145
1-acetyl-N-(2-chloro-4,6-dimethylphenyl)piperidine-3-carboxamide (PubChem CID 110686145) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-acetyl-N-(2-chloro-4,6-dimethylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-acetyl-N-(2-chloro-4,6-dimethylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110686145 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-acetyl-N-(2-chloro-4,6-dimethylphenyl)piperidine-3-carboxamide |
| SMILES | CC(=O)N1CCCC(C(=O)Nc2c(C)cc(C)cc2Cl)C1 |
| InChI | InChI=1S/C16H21ClN2O2/c1-10-7-11(2)15(14(17)8-10)18-16(21)13-5-4-6-19(9-13)12(3)20/h7-8,13H,4-6,9H2,1-3H3,(H,18,21) |
| InChIKey | NLDXAESSOZIUBY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |