C18H18F3NO3 — CID 1106868
(2R)-7,7-dimethyl-2-(4-methylphenyl)-2-(trifluoromethyl)-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione (PubChem CID 1106868) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is (2R)-7,7-dimethyl-2-(4-methylphenyl)-2-(trifluoromethyl)-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione.
| Compound Name | (2R)-7,7-dimethyl-2-(4-methylphenyl)-2-(trifluoromethyl)-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione |
|---|---|
| PubChem CID | 1106868 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2R)-7,7-dimethyl-2-(4-methylphenyl)-2-(trifluoromethyl)-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione |
| SMILES | Cc1ccc([C@@]2(C(F)(F)F)NC(=O)C3=C(CC(C)(C)CC3=O)O2)cc1 |
| InChI | InChI=1S/C18H18F3NO3/c1-10-4-6-11(7-5-10)17(18(19,20)21)22-15(24)14-12(23)8-16(2,3)9-13(14)25-17/h4-7H,8-9H2,1-3H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | MDCFNRHICQYKAN-QGZVFWFLSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|