C20H25NO3 — CID 2305538
(2R)-2-tert-butyl-7,7-dimethyl-2-phenyl-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione (PubChem CID 2305538) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2R)-2-tert-butyl-7,7-dimethyl-2-phenyl-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione.
| Compound Name | (2R)-2-tert-butyl-7,7-dimethyl-2-phenyl-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione |
|---|---|
| PubChem CID | 2305538 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2R)-2-tert-butyl-7,7-dimethyl-2-phenyl-6,8-dihydro-3H-1,3-benzoxazine-4,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@@](c1ccccc1)(C(C)(C)C)NC2=O |
| InChI | InChI=1S/C20H25NO3/c1-18(2,3)20(13-9-7-6-8-10-13)21-17(23)16-14(22)11-19(4,5)12-15(16)24-20/h6-10H,11-12H2,1-5H3,(H,21,23)/t20-/m0/s1 |
| InChIKey | UEIYKBYQBDNRLI-FQEVSTJZSA-N |
| XLogP | 3.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|