C10H14N4O3S — CID 110687779
2-(1,1-dioxothiazinan-2-yl)-N-pyrimidin-2-ylacetamide (PubChem CID 110687779) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiazinan-2-yl)-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-(1,1-dioxothiazinan-2-yl)-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 110687779 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(1,1-dioxothiazinan-2-yl)-N-pyrimidin-2-ylacetamide |
| SMILES | O=C(CN1CCCCS1(=O)=O)Nc1ncccn1 |
| InChI | InChI=1S/C10H14N4O3S/c15-9(13-10-11-4-3-5-12-10)8-14-6-1-2-7-18(14,16)17/h3-5H,1-2,6-8H2,(H,11,12,13,15) |
| InChIKey | JSQKZDKYGCRREP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |