C17H20N2O2 — CID 110689025
N-(4-acetylphenyl)-3-(2,5-dimethylpyrrol-1-yl)propanamide (PubChem CID 110689025) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(4-acetylphenyl)-3-(2,5-dimethylpyrrol-1-yl)propanamide.
| Compound Name | N-(4-acetylphenyl)-3-(2,5-dimethylpyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 110689025 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(4-acetylphenyl)-3-(2,5-dimethylpyrrol-1-yl)propanamide |
| SMILES | CC(=O)c1ccc(NC(=O)CCn2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C17H20N2O2/c1-12-4-5-13(2)19(12)11-10-17(21)18-16-8-6-15(7-9-16)14(3)20/h4-9H,10-11H2,1-3H3,(H,18,21) |
| InChIKey | HKRVREXHBUFPKV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |