C14H16ClN5O — CID 110691694
[4-(3-chlorophenyl)piperazin-1-yl]-(5-methyl-2H-triazol-4-yl)methanone (PubChem CID 110691694) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(5-methyl-2H-triazol-4-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(5-methyl-2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 110691694 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(5-methyl-2H-triazol-4-yl)methanone |
| SMILES | Cc1n[nH]nc1C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16ClN5O/c1-10-13(17-18-16-10)14(21)20-7-5-19(6-8-20)12-4-2-3-11(15)9-12/h2-4,9H,5-8H2,1H3,(H,16,17,18) |
| InChIKey | AOVGIJXRRDXDCM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |