C22H30O5S — CID 11069528
methyl (2S)-2-[(1aS,2S,4R,4aR,7R,8aR)-4-(benzenesulfinyl)-2-hydroxy-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate (PubChem CID 11069528) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is methyl (2S)-2-[(1aS,2S,4R,4aR,7R,8aR)-4-(benzenesulfinyl)-2-hydroxy-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate.
| Compound Name | methyl (2S)-2-[(1aS,2S,4R,4aR,7R,8aR)-4-(benzenesulfinyl)-2-hydroxy-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate |
|---|---|
| PubChem CID | 11069528 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | methyl (2S)-2-[(1aS,2S,4R,4aR,7R,8aR)-4-(benzenesulfinyl)-2-hydroxy-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H]1CC[C@@]2(C)[C@H](S(=O)c3ccccc3)C[C@H](O)[C@]3(C)O[C@]23C1 |
| InChI | InChI=1S/C22H30O5S/c1-14(19(24)26-4)15-10-11-20(2)18(28(25)16-8-6-5-7-9-16)12-17(23)21(3)22(20,13-15)27-21/h5-9,14-15,17-18,23H,10-13H2,1-4H3/t14-,15+,17-,18+,20-,21-,22+,28?/m0/s1 |
| InChIKey | DPCKXADAZXRVEA-NUKVJTSQSA-N |
| XLogP | 3.07 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|