C23H32O4S — CID 101348389
[(1R,2R,5S,6R,7R,9S,12R)-12-hydroxy-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate (PubChem CID 101348389) has the molecular formula C23H32O4S and a molecular weight of 404.57 g/mol. Its IUPAC name is [(1R,2R,5S,6R,7R,9S,12R)-12-hydroxy-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate.
| Compound Name | [(1R,2R,5S,6R,7R,9S,12R)-12-hydroxy-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate |
|---|---|
| PubChem CID | 101348389 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [(1R,2R,5S,6R,7R,9S,12R)-12-hydroxy-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H](C)[C@@]23OC(C)(C)[C@@H](C[C@@H](Sc4ccccc4)[C@]12C)[C@H]3O |
| InChI | InChI=1S/C23H32O4S/c1-14-11-12-18(26-15(2)24)22(5)19(28-16-9-7-6-8-10-16)13-17-20(25)23(14,22)27-21(17,3)4/h6-10,14,17-20,25H,11-13H2,1-5H3/t14-,17+,18+,19-,20-,22+,23+/m1/s1 |
| InChIKey | JPKNAPOJLRSRJO-YPQNXZMVSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |