C27H38O6S — CID 553318
[4-acetyloxy-8-(1,3-dioxolan-2-yl)-1,2-dimethyl-5-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]methyl acetate (PubChem CID 553318) has the molecular formula C27H38O6S and a molecular weight of 490.66 g/mol. Its IUPAC name is [4-acetyloxy-8-(1,3-dioxolan-2-yl)-1,2-dimethyl-5-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]methyl acetate.
| Compound Name | [4-acetyloxy-8-(1,3-dioxolan-2-yl)-1,2-dimethyl-5-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 553318 |
| Molecular Formula | C27H38O6S |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [4-acetyloxy-8-(1,3-dioxolan-2-yl)-1,2-dimethyl-5-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]methyl acetate |
| SMILES | CC(=O)OCC12C(CSc3ccccc3)CCC(C3OCCO3)C1C(C)C(C)CC2OC(C)=O |
| InChI | InChI=1S/C27H38O6S/c1-17-14-24(33-20(4)29)27(16-32-19(3)28)21(15-34-22-8-6-5-7-9-22)10-11-23(25(27)18(17)2)26-30-12-13-31-26/h5-9,17-18,21,23-26H,10-16H2,1-4H3 |
| InChIKey | ZNTHQILPTBOBRU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |