C22H32O2S — CID 10893765
(4'R,4'aS,8'S,8'aS)-4',4'a,8'a-trimethyl-8'-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene] (PubChem CID 10893765) has the molecular formula C22H32O2S and a molecular weight of 360.56 g/mol. Its IUPAC name is (4'R,4'aS,8'S,8'aS)-4',4'a,8'a-trimethyl-8'-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene].
| Compound Name | (4'R,4'aS,8'S,8'aS)-4',4'a,8'a-trimethyl-8'-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 10893765 |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (4'R,4'aS,8'S,8'aS)-4',4'a,8'a-trimethyl-8'-(phenylsulfanylmethyl)spiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene] |
| SMILES | C[C@@H]1CCC[C@@]2(C)C(CSc3ccccc3)C3(CC[C@@]12C)OCCO3 |
| InChI | InChI=1S/C22H32O2S/c1-17-8-7-11-21(3)19(16-25-18-9-5-4-6-10-18)22(23-14-15-24-22)13-12-20(17,21)2/h4-6,9-10,17,19H,7-8,11-16H2,1-3H3/t17-,19?,20+,21+/m1/s1 |
| InChIKey | AGOGQTPMLBLQMN-KMBITTBOSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |