C28H32O3S — CID 91568582
(8'S,13'S,14'S)-17'-[2-(benzenesulfinyl)ethenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene] (PubChem CID 91568582) has the molecular formula C28H32O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is (8'S,13'S,14'S)-17'-[2-(benzenesulfinyl)ethenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene].
| Compound Name | (8'S,13'S,14'S)-17'-[2-(benzenesulfinyl)ethenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 91568582 |
| Molecular Formula | C28H32O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (8'S,13'S,14'S)-17'-[2-(benzenesulfinyl)ethenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene] |
| SMILES | C[C@]12CC=C3C4=C(CC[C@H]3[C@@H]1CC=C2C=CS(=O)c1ccccc1)CC1(CC4)OCCO1 |
| InChI | InChI=1S/C28H32O3S/c1-27-14-11-24-23-12-15-28(30-16-17-31-28)19-20(23)7-9-25(24)26(27)10-8-21(27)13-18-32(29)22-5-3-2-4-6-22/h2-6,8,11,13,18,25-26H,7,9-10,12,14-17,19H2,1H3/t25-,26+,27-,32?/m1/s1 |
| InChIKey | LFZPFEPCZNUUQJ-RBSOPIHNSA-N |
| XLogP | 6.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |