C28H32O3S — CID 72190496
17-[2-(Benzenesulfinyl)ethenylidene]-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] (PubChem CID 72190496) has the molecular formula C28H32O3S and a molecular weight of 448.60 g/mol. Its IUPAC name is 17-[2-(benzenesulfinyl)ethenylidene]-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane].
| Compound Name | 17-[2-(Benzenesulfinyl)ethenylidene]-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 72190496 |
| Molecular Formula | C28H32O3S |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 17-[2-(benzenesulfinyl)ethenylidene]-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] |
| SMILES | CC12CC=C3C(C1CCC2=C=CS(=O)C4=CC=CC=C4)CCC5=C3CCC6(C5)OCCO6 |
| InChI | InChI=1S/C28H32O3S/c1-27-14-11-24-23-12-15-28(30-16-17-31-28)19-20(23)7-9-25(24)26(27)10-8-21(27)13-18-32(29)22-5-3-2-4-6-22/h2-6,11,18,25-26H,7-10,12,14-17,19H2,1H3 |
| InChIKey | MMTZMSYIRLXDLW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | 924 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |