C26H36O4S — CID 10575308
(1R,7R)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-9-octyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene (PubChem CID 10575308) has the molecular formula C26H36O4S and a molecular weight of 444.64 g/mol. Its IUPAC name is (1R,7R)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-9-octyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene.
| Compound Name | (1R,7R)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-9-octyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene |
|---|---|
| PubChem CID | 10575308 |
| Molecular Formula | C26H36O4S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (1R,7R)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-9-octyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene |
| SMILES | CCCCCCCCC1=C(S(=O)(=O)c2ccc(C)cc2)[C@@H]2C=C[C@H]1C1OC(C)(C)OC12 |
| InChI | InChI=1S/C26H36O4S/c1-5-6-7-8-9-10-11-21-20-16-17-22(24-23(20)29-26(3,4)30-24)25(21)31(27,28)19-14-12-18(2)13-15-19/h12-17,20,22-24H,5-11H2,1-4H3/t20-,22-,23?,24?/m1/s1 |
| InChIKey | SXRXQOJRQXYKAU-PZEZIAQESA-N |
| XLogP | 6.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|