C30H40O6S — CID 134937516
methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-14-phenylsulfanyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate (PubChem CID 134937516) has the molecular formula C30H40O6S and a molecular weight of 528.71 g/mol. Its IUPAC name is methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-14-phenylsulfanyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate.
| Compound Name | methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-14-phenylsulfanyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate |
|---|---|
| PubChem CID | 134937516 |
| Molecular Formula | C30H40O6S |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-14-phenylsulfanyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)[C@H]3CCC(Sc4ccccc4)=C4CC(OC)O[C@H](C[C@H]21)[C@@]43COC(C)=O |
| InChI | InChI=1S/C30H40O6S/c1-19(31)35-18-30-21-16-26(33-4)36-25(30)17-24-28(2,14-9-15-29(24,3)27(32)34-5)23(30)13-12-22(21)37-20-10-7-6-8-11-20/h6-8,10-11,23-26H,9,12-18H2,1-5H3/t23-,24-,25-,26?,28-,29+,30+/m1/s1 |
| InChIKey | CWDGDGKTZUZOQE-OCIBACOVSA-N |
| XLogP | 6.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |