C21H28O3S — CID 101348387
(1R,5S,6R,7R,9S,12R)-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-5,12-diol (PubChem CID 101348387) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is (1R,5S,6R,7R,9S,12R)-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-5,12-diol.
| Compound Name | (1R,5S,6R,7R,9S,12R)-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-5,12-diol |
|---|---|
| PubChem CID | 101348387 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (1R,5S,6R,7R,9S,12R)-2,6,10,10-tetramethyl-7-phenylsulfanyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-5,12-diol |
| SMILES | CC1=CC[C@H](O)[C@@]2(C)[C@H](Sc3ccccc3)C[C@H]3[C@@H](O)[C@@]12OC3(C)C |
| InChI | InChI=1S/C21H28O3S/c1-13-10-11-16(22)20(4)17(25-14-8-6-5-7-9-14)12-15-18(23)21(13,20)24-19(15,2)3/h5-10,15-18,22-23H,11-12H2,1-4H3/t15-,16-,17+,18+,20-,21-/m0/s1 |
| InChIKey | LGWPXOYVPPSPPS-WDPSMDGFSA-N |
| XLogP | 3.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|