C19H26N2O3 — CID 110699024
1-tert-butyl-N-[2-(2,5-dimethoxyphenyl)ethyl]pyrrole-3-carboxamide (PubChem CID 110699024) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-tert-butyl-N-[2-(2,5-dimethoxyphenyl)ethyl]pyrrole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[2-(2,5-dimethoxyphenyl)ethyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 110699024 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-tert-butyl-N-[2-(2,5-dimethoxyphenyl)ethyl]pyrrole-3-carboxamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)c2ccn(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-19(2,3)21-11-9-15(13-21)18(22)20-10-8-14-12-16(23-4)6-7-17(14)24-5/h6-7,9,11-13H,8,10H2,1-5H3,(H,20,22) |
| InChIKey | XLEOPUZHCUWPTD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |