C15H9F3N2O3 — CID 110701657
3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-8-carboxamide (PubChem CID 110701657) has the molecular formula C15H9F3N2O3 and a molecular weight of 322.24 g/mol. Its IUPAC name is 3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-8-carboxamide.
| Compound Name | 3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 110701657 |
| Molecular Formula | C15H9F3N2O3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-oxo-N-(2,3,4-trifluorophenyl)-4H-1,4-benzoxazine-8-carboxamide |
| SMILES | O=C1COc2c(cccc2C(=O)Nc2ccc(F)c(F)c2F)N1 |
| InChI | InChI=1S/C15H9F3N2O3/c16-8-4-5-9(13(18)12(8)17)20-15(22)7-2-1-3-10-14(7)23-6-11(21)19-10/h1-5H,6H2,(H,19,21)(H,20,22) |
| InChIKey | NNUWNMLRFWJTOF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|