C17H14N2O5 — CID 119353511
4-[[(3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]methyl]benzoic acid (PubChem CID 119353511) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 4-[[(3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 119353511 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[[(3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]methyl]benzoic acid |
| SMILES | O=C1COc2c(cccc2C(=O)NCc2ccc(C(=O)O)cc2)N1 |
| InChI | InChI=1S/C17H14N2O5/c20-14-9-24-15-12(2-1-3-13(15)19-14)16(21)18-8-10-4-6-11(7-5-10)17(22)23/h1-7H,8-9H2,(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | ZXXKQLJYOLMSKL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |