C12H12N4O3 — CID 110702050
N-(3,5-dimethylphenyl)-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide (PubChem CID 110702050) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 110702050 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2n[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C12H12N4O3/c1-6-3-7(2)5-8(4-6)13-10(17)9-11(18)14-12(19)16-15-9/h3-5H,1-2H3,(H,13,17)(H2,14,16,18,19) |
| InChIKey | WTFOQVJJOZCWSL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |