C14H17N5O3 — CID 110702097
N-[4-(diethylamino)phenyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide (PubChem CID 110702097) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 110702097 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2n[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H17N5O3/c1-3-19(4-2)10-7-5-9(6-8-10)15-12(20)11-13(21)16-14(22)18-17-11/h5-8H,3-4H2,1-2H3,(H,15,20)(H2,16,18,21,22) |
| InChIKey | HQOXWQBHWSWLJN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|