C17H23BrN4O — CID 56560029
4-bromo-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 56560029) has the molecular formula C17H23BrN4O and a molecular weight of 379.30 g/mol. Its IUPAC name is 4-bromo-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56560029 |
| Molecular Formula | C17H23BrN4O |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-bromo-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2n[nH]c(C(C)C)c2Br)cc1 |
| InChI | InChI=1S/C17H23BrN4O/c1-5-22(6-2)13-9-7-12(8-10-13)19-17(23)16-14(18)15(11(3)4)20-21-16/h7-11H,5-6H2,1-4H3,(H,19,23)(H,20,21) |
| InChIKey | QGIPNSPTXSXYLR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|