C12H11N3O2 — CID 110702484
2-oxo-N-prop-2-enyl-1H-quinazoline-4-carboxamide (PubChem CID 110702484) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-oxo-N-prop-2-enyl-1H-quinazoline-4-carboxamide.
| Compound Name | 2-oxo-N-prop-2-enyl-1H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 110702484 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-oxo-N-prop-2-enyl-1H-quinazoline-4-carboxamide |
| SMILES | C=CCNC(=O)c1nc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C12H11N3O2/c1-2-7-13-11(16)10-8-5-3-4-6-9(8)14-12(17)15-10/h2-6H,1,7H2,(H,13,16)(H,14,15,17) |
| InChIKey | AEQIULDGNKEJCJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|