C15H10FN3O2 — CID 110702579
N-(2-fluorophenyl)-2-oxo-1H-quinazoline-4-carboxamide (PubChem CID 110702579) has the molecular formula C15H10FN3O2 and a molecular weight of 283.26 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-oxo-1H-quinazoline-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2-oxo-1H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 110702579 |
| Molecular Formula | C15H10FN3O2 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(2-fluorophenyl)-2-oxo-1H-quinazoline-4-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1nc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H10FN3O2/c16-10-6-2-4-8-12(10)17-14(20)13-9-5-1-3-7-11(9)18-15(21)19-13/h1-8H,(H,17,20)(H,18,19,21) |
| InChIKey | DQWGFWOCPRVTPV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |