C20H14FN3O4 — CID 135936848
N-(2-fluorophenyl)-2-(3,4,5-trihydroxyphenyl)-1H-benzimidazole-4-carboxamide (PubChem CID 135936848) has the molecular formula C20H14FN3O4 and a molecular weight of 379.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(3,4,5-trihydroxyphenyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2-(3,4,5-trihydroxyphenyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 135936848 |
| Molecular Formula | C20H14FN3O4 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(2-fluorophenyl)-2-(3,4,5-trihydroxyphenyl)-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1cccc2[nH]c(-c3cc(O)c(O)c(O)c3)nc12 |
| InChI | InChI=1S/C20H14FN3O4/c21-12-5-1-2-6-13(12)23-20(28)11-4-3-7-14-17(11)24-19(22-14)10-8-15(25)18(27)16(26)9-10/h1-9,25-27H,(H,22,24)(H,23,28) |
| InChIKey | CSSYXFFYQXSYMV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|