C18H18N4O — CID 110702828
N,2-dimethyl-N-(2-pyridin-4-ylethyl)quinazoline-4-carboxamide (PubChem CID 110702828) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is N,2-dimethyl-N-(2-pyridin-4-ylethyl)quinazoline-4-carboxamide.
| Compound Name | N,2-dimethyl-N-(2-pyridin-4-ylethyl)quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 110702828 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N,2-dimethyl-N-(2-pyridin-4-ylethyl)quinazoline-4-carboxamide |
| SMILES | Cc1nc(C(=O)N(C)CCc2ccncc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H18N4O/c1-13-20-16-6-4-3-5-15(16)17(21-13)18(23)22(2)12-9-14-7-10-19-11-8-14/h3-8,10-11H,9,12H2,1-2H3 |
| InChIKey | RIGSDXRDKGRZJL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |