C16H20N4O4 — CID 110703579
2-(1-methyl-3,5-dioxopyrazolidin-4-yl)-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 110703579) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(1-methyl-3,5-dioxopyrazolidin-4-yl)-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(1-methyl-3,5-dioxopyrazolidin-4-yl)-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110703579 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-(1-methyl-3,5-dioxopyrazolidin-4-yl)-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | CN1NC(=O)C(CC(=O)Nc2ccccc2N2CCOCC2)C1=O |
| InChI | InChI=1S/C16H20N4O4/c1-19-16(23)11(15(22)18-19)10-14(21)17-12-4-2-3-5-13(12)20-6-8-24-9-7-20/h2-5,11H,6-10H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | FGTIBSAMDMSBJK-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|