C12H11F2N3O3 — CID 110703624
N-(2,6-difluorophenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide (PubChem CID 110703624) has the molecular formula C12H11F2N3O3 and a molecular weight of 283.23 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 110703624 |
| Molecular Formula | C12H11F2N3O3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
| SMILES | CN1NC(=O)C(CC(=O)Nc2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C12H11F2N3O3/c1-17-12(20)6(11(19)16-17)5-9(18)15-10-7(13)3-2-4-8(10)14/h2-4,6H,5H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | GIOWJVSSDYFQGI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|