C13H11ClN4O3S — CID 110703608
N-(6-chloro-1,3-benzothiazol-2-yl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide (PubChem CID 110703608) has the molecular formula C13H11ClN4O3S and a molecular weight of 338.78 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 110703608 |
| Molecular Formula | C13H11ClN4O3S |
| Molecular Weight | 338.78 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
| SMILES | CN1NC(=O)C(CC(=O)Nc2nc3ccc(Cl)cc3s2)C1=O |
| InChI | InChI=1S/C13H11ClN4O3S/c1-18-12(21)7(11(20)17-18)5-10(19)16-13-15-8-3-2-6(14)4-9(8)22-13/h2-4,7H,5H2,1H3,(H,17,20)(H,15,16,19) |
| InChIKey | CHHKZAFRWSWTJM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|