C12H9ClN4O3S — CID 110686818
N-(6-chloro-1,3-benzothiazol-2-yl)-2-(2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 110686818) has the molecular formula C12H9ClN4O3S and a molecular weight of 324.75 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2-(2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 110686818 |
| Molecular Formula | C12H9ClN4O3S |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C12H9ClN4O3S/c13-6-1-2-7-8(3-6)21-11(15-7)16-9(18)5-17-10(19)4-14-12(17)20/h1-3H,4-5H2,(H,14,20)(H,15,16,18) |
| InChIKey | XEBFHVSVCWTZTL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|