C15H20F2N2O — CID 43405285
2-(cyclohexylmethylamino)-N-(2,6-difluorophenyl)acetamide (PubChem CID 43405285) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-(cyclohexylmethylamino)-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-(cyclohexylmethylamino)-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 43405285 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(cyclohexylmethylamino)-N-(2,6-difluorophenyl)acetamide |
| SMILES | O=C(CNCC1CCCCC1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H20F2N2O/c16-12-7-4-8-13(17)15(12)19-14(20)10-18-9-11-5-2-1-3-6-11/h4,7-8,11,18H,1-3,5-6,9-10H2,(H,19,20) |
| InChIKey | DRYUXEWEMUWGTF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |