C11H11ClF2N2O — CID 115745436
2-(2-chloroprop-2-enylamino)-N-(2,6-difluorophenyl)acetamide (PubChem CID 115745436) has the molecular formula C11H11ClF2N2O and a molecular weight of 260.67 g/mol. Its IUPAC name is 2-(2-chloroprop-2-enylamino)-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-(2-chloroprop-2-enylamino)-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 115745436 |
| Molecular Formula | C11H11ClF2N2O |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-(2-chloroprop-2-enylamino)-N-(2,6-difluorophenyl)acetamide |
| SMILES | C=C(Cl)CNCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H11ClF2N2O/c1-7(12)5-15-6-10(17)16-11-8(13)3-2-4-9(11)14/h2-4,15H,1,5-6H2,(H,16,17) |
| InChIKey | DTULTYVWVWUUOB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |