C14H19F2N3OS — CID 106325135
N-(2,6-difluorophenyl)-2-(2-thiomorpholin-4-ylethylamino)acetamide (PubChem CID 106325135) has the molecular formula C14H19F2N3OS and a molecular weight of 315.39 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(2-thiomorpholin-4-ylethylamino)acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(2-thiomorpholin-4-ylethylamino)acetamide |
|---|---|
| PubChem CID | 106325135 |
| Molecular Formula | C14H19F2N3OS |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(2-thiomorpholin-4-ylethylamino)acetamide |
| SMILES | O=C(CNCCN1CCSCC1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2N3OS/c15-11-2-1-3-12(16)14(11)18-13(20)10-17-4-5-19-6-8-21-9-7-19/h1-3,17H,4-10H2,(H,18,20) |
| InChIKey | KNMLNNOQDWKLJK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|