C11H13F2N3O2 — CID 43626499
3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]propanamide (PubChem CID 43626499) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is 3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]propanamide.
| Compound Name | 3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 43626499 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]propanamide |
| SMILES | NC(=O)CCNCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2N3O2/c12-7-2-1-3-8(13)11(7)16-10(18)6-15-5-4-9(14)17/h1-3,15H,4-6H2,(H2,14,17)(H,16,18) |
| InChIKey | GNUFRCMOVYTLTJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|