C14H20F2N2O — CID 109032108
N-(2,6-difluorophenyl)-3-(3-methylbutylamino)propanamide (PubChem CID 109032108) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-3-(3-methylbutylamino)propanamide.
| Compound Name | N-(2,6-difluorophenyl)-3-(3-methylbutylamino)propanamide |
|---|---|
| PubChem CID | 109032108 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(2,6-difluorophenyl)-3-(3-methylbutylamino)propanamide |
| SMILES | CC(C)CCNCCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C14H20F2N2O/c1-10(2)6-8-17-9-7-13(19)18-14-11(15)4-3-5-12(14)16/h3-5,10,17H,6-9H2,1-2H3,(H,18,19) |
| InChIKey | MIVZYZFFVCKFCC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|