C11H13F2N3O3 — CID 106174311
3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]-2-hydroxypropanamide (PubChem CID 106174311) has the molecular formula C11H13F2N3O3 and a molecular weight of 273.24 g/mol. Its IUPAC name is 3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174311 |
| Molecular Formula | C11H13F2N3O3 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[[2-(2,6-difluoroanilino)-2-oxoethyl]amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2N3O3/c12-6-2-1-3-7(13)10(6)16-9(18)5-15-4-8(17)11(14)19/h1-3,8,15,17H,4-5H2,(H2,14,19)(H,16,18) |
| InChIKey | OHRGVKCSPJAJAJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |