C15H22F2N2O2 — CID 106115065
N-(2,6-difluorophenyl)-2-[2-(2-hydroxyethyl)pentylamino]acetamide (PubChem CID 106115065) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[2-(2-hydroxyethyl)pentylamino]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[2-(2-hydroxyethyl)pentylamino]acetamide |
|---|---|
| PubChem CID | 106115065 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[2-(2-hydroxyethyl)pentylamino]acetamide |
| SMILES | CCCC(CCO)CNCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H22F2N2O2/c1-2-4-11(7-8-20)9-18-10-14(21)19-15-12(16)5-3-6-13(15)17/h3,5-6,11,18,20H,2,4,7-10H2,1H3,(H,19,21) |
| InChIKey | OVNQUTBIPOGQDT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |